N-Acetyl-D-glucosamine structure
|
Common Name | N-Acetyl-D-glucosamine | ||
|---|---|---|---|---|
| CAS Number | 134451-94-8 | Molecular Weight | 221.208 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 636.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C8H15NO6 | Melting Point | 211 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 338.7±31.5 °C | |
| Name | N-Acetyl-D-glucosamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 636.4±55.0 °C at 760 mmHg |
| Melting Point | 211 °C (dec.)(lit.) |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.208 |
| Flash Point | 338.7±31.5 °C |
| Exact Mass | 221.089935 |
| PSA | 119.25000 |
| LogP | -2.68 |
| Appearance of Characters | powder,white to off-white |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | MBLBDJOUHNCFQT-KVPKETBZSA-N |
| SMILES | CC(=O)NC(C=O)C(O)C(O)C(O)CO |
| Storage condition | −20°C |
| Water Solubility | H2O: 50 mg/mL colorless to faint yellow solution, clear to very slightly hazy |
| WGK Germany | 3 |
|---|---|
| RTECS | LZ6651000 |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00061615 |
| 2-Acetamido-2-deoxy-D-glucose |
| 2-Acetamido-2-deoxyglucose |
| 2-Acetylamino-2-deoxy-D-glucose |
| D-Glucose, 2- (acetylamino)-2-deoxy- |
| D-Glucose, 2-acetamido-2-deoxy- |
| EINECS 231-368-2 |
| D-Glucose, 2-(acetylamino)-2-deoxy- |
| N-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| 2-Acetamido-2-deoxy-b-D-glucose |
| 2-Acetamido-2-deoxy-β-D-glucose |
| N-[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |