SALMFamide 2
Modify Date: 2025-08-26 05:58:18
SALMFamide 2 structure
|
Common Name | SALMFamide 2 | ||
|---|---|---|---|---|
| CAS Number | 134439-74-0 | Molecular Weight | 1275.365 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1818.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C59H82N14O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1053.6±34.3 °C | |
Use of SALMFamide 2SALMF amide 2, a neuropeptide S2 from the starfish Asterias rubens, is involved in the regulation of eversion of the cardiac stomach in starfish[1]. |
| Name | L-Serylglycyl-L-prolyl-L-tyrosyl-L-seryl-L-phenylalanyl-L-asparaginyl-L-serylglycyl-L-leucyl-L-threonyl-L-phenylalaninamide |
|---|---|
| Synonym | More Synonyms |
| Description | SALMF amide 2, a neuropeptide S2 from the starfish Asterias rubens, is involved in the regulation of eversion of the cardiac stomach in starfish[1]. |
|---|---|
| Related Catalog | |
| In Vivo | SALMF amide 2 (1 mM) can lead to cardiac ectopia of starfish by injection into the perivisceral coelom after 5 min[1]. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1818.5±65.0 °C at 760 mmHg |
| Molecular Formula | C59H82N14O18 |
| Molecular Weight | 1275.365 |
| Flash Point | 1053.6±34.3 °C |
| Exact Mass | 1274.593140 |
| LogP | -1.51 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | ULORYJBIPHKGST-MMPVZCTRSA-N |
| SMILES | CC(C)CC(NC(=O)CNC(=O)C(CO)NC(=O)C(CC(N)=O)NC(=O)C(Cc1ccccc1)NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C1CCCN1C(=O)CNC(=O)C(N)CO)C(=O)NC(C(=O)NC(Cc1ccccc1)C(N)=O)C(C)O |
| L-Phenylalaninamide, L-serylglycyl-L-prolyl-L-tyrosyl-L-seryl-L-phenylalanyl-L-asparaginyl-L-serylglycyl-L-leucyl-L-threonyl- |
| L-Serylglycyl-L-prolyl-L-tyrosyl-L-seryl-L-phenylalanyl-L-asparaginyl-L-serylglycyl-L-leucyl-L-threonyl-L-phenylalaninamide |