Heptyl(triphenyl)phosphonium bromide structure
|
Common Name | Heptyl(triphenyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 13423-48-8 | Molecular Weight | 441.384 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H30BrP | Melting Point | 173-176 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-Heptyltriphenylphosphonium Bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 173-176 °C(lit.) |
|---|---|
| Molecular Formula | C25H30BrP |
| Molecular Weight | 441.384 |
| Exact Mass | 440.126831 |
| PSA | 13.59000 |
| LogP | 2.95490 |
| InChIKey | WCZSOHSGMBVYFW-UHFFFAOYSA-M |
| SMILES | CCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~10%
Heptyl(tripheny... CAS#:13423-48-8 |
| Literature: Pempo, Delphine; Cintrat, Jean-Christophe; Parrain, Jean-Luc; Santelli, Maurice Tetrahedron, 2000 , vol. 56, # 30 p. 5493 - 5497 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Regulation of mitochondrial ceramide distribution by members of the BCL-2 family.
J. Lipid Res. 56 , 1501-10, (2015) Apoptosis is an intricately regulated cellular process that proceeds through different cell type- and signal-dependent pathways. In the mitochondrial apoptotic program, mitochondrial outer membrane pe... |
| Heptyl(triphenyl)phosphonium bromide |
| n-Heptyltriphenylphosphonium Bromide |
| Phosphonium, heptyltriphenyl-, bromide (1:1) |
| heptyl(triphenyl)phosphanium,bromide |
| Heptyltriphenylphosphonium Bromide |
| EINECS 236-539-5 |
| MFCD00050249 |