1-Galloyl-beta-glucose structure
|
Common Name | 1-Galloyl-beta-glucose | ||
|---|---|---|---|---|
| CAS Number | 13405-60-2 | Molecular Weight | 332.26000 | |
| Density | 1.85 | Boiling Point | N/A | |
| Molecular Formula | C13H16O10 | Melting Point | 214℃ | |
| MSDS | USA | Flash Point | N/A | |
Use of 1-Galloyl-beta-glucoseβ-Glucogallin is a potent and selective aldose reductase (AKR1B1) inhibitor. β-Glucogallin can be isolated from the medicinal plant Emblica officinalis[1]. |
| Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | β-Glucogallin is a potent and selective aldose reductase (AKR1B1) inhibitor. β-Glucogallin can be isolated from the medicinal plant Emblica officinalis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.85 |
|---|---|
| Melting Point | 214℃ |
| Molecular Formula | C13H16O10 |
| Molecular Weight | 332.26000 |
| Exact Mass | 332.07400 |
| PSA | 177.14000 |
| Vapour Pressure | 9.04E-23mmHg at 25°C |
| InChIKey | GDVRUDXLQBVIKP-HQHREHCSSA-N |
| SMILES | O=C(OC1OC(CO)C(O)C(O)C1O)c1cc(O)c(O)c(O)c1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3,4,5-trihydroxybenzoate |
| 1-O-Galloyl-β-D-glucose |
| 1-Galloyl-beta-glucose |
| β-Glucogalin |