Menthyl anthranilate structure
|
Common Name | Menthyl anthranilate | ||
|---|---|---|---|---|
| CAS Number | 134-09-8 | Molecular Weight | 275.38600 | |
| Density | 1.04 | Boiling Point | 177-179ºC (3 mmHg) | |
| Molecular Formula | C17H25NO2 | Melting Point | 62.5-63.5° | |
| MSDS | Chinese USA | Flash Point | >110ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04 |
|---|---|
| Boiling Point | 177-179ºC (3 mmHg) |
| Melting Point | 62.5-63.5° |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.38600 |
| Flash Point | >110ºC |
| Exact Mass | 275.18900 |
| PSA | 52.32000 |
| LogP | 4.46760 |
| Vapour Pressure | 4.38E-06mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | SOXAGEOHPCXXIO-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccccc2N)C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922439000 |
| HS Code | 2922439000 |
|---|---|
| Summary | 2922439000 anthranilic acid salts。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Optimization of an analytical methodology for the simultaneous determination of different classes of ultraviolet filters in cosmetics by pressurized liquid extraction-gas chromatography tandem mass spectrometry.
J. Chromatogr. A. 1405 , 12-22, (2015) A methodology based on pressurized liquid extraction (PLE) followed by gas chromatography-tandem mass spectrometry (GC-MS/MS) has been developed for the simultaneous analysis of different classes of U... |
| Anthranilsaeure-menthylester |
| MFCD00045487 |
| EINECS 205-129-8 |
| 5-methyl-2-(1-methyl-ethyl)-cyclohexyl 2-aminobenzoate |
| anthranilic acid menthyl ester |
| menthyl antranilate |
| Meradimate |
| Menthyl o-aminobenzoate |
| Menthyl o-aminobenzoate,Menthyl anthranilate |
| Meradimate [INN] |
| MENTHYL ANTHRANILATE |
| UNII-J9QGD60OUZ |