BMS-903452 structure
|
Common Name | BMS-903452 | ||
|---|---|---|---|---|
| CAS Number | 1339944-47-6 | Molecular Weight | 513.369 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 735.7±70.0 °C at 760 mmHg | |
| Molecular Formula | C21H19Cl2FN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 398.7±35.7 °C | |
Use of BMS-903452BMS-903452 is a potent and selective GPR119 agonist for diabetes research[1]. |
| Name | 49731B9ULN |
|---|---|
| Synonym | More Synonyms |
| Description | BMS-903452 is a potent and selective GPR119 agonist for diabetes research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 735.7±70.0 °C at 760 mmHg |
| Molecular Formula | C21H19Cl2FN4O4S |
| Molecular Weight | 513.369 |
| Flash Point | 398.7±35.7 °C |
| Exact Mass | 512.048828 |
| LogP | 2.19 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | OGIAVRWXUPYGGC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(-n2cc(Cl)c(OC3CCN(c4ncc(Cl)cn4)CC3)cc2=O)c(F)c1 |
| 49731B9ULN |
| BMS-903452 |
| 2(1H)-Pyridinone, 5-chloro-4-[[1-(5-chloro-2-pyrimidinyl)-4-piperidinyl]oxy]-1-[2-fluoro-4-(methylsulfonyl)phenyl]- |
| 5-Chloro-4-{[1-(5-chloro-2-pyrimidinyl)-4-piperidinyl]oxy}-1-[2-fluoro-4-(methylsulfonyl)phenyl]-2(1H)-pyridinone |