5,5-Dimethyl-2,4-dioxohexanoic Acid Ethyl Ester structure
|
Common Name | 5,5-Dimethyl-2,4-dioxohexanoic Acid Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 13395-36-3 | Molecular Weight | 200.23200 | |
| Density | 1.046g/cm3 | Boiling Point | 68ºC (0.5 torr) | |
| Molecular Formula | C10H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.7ºC | |
| Name | Ethyl 5,5-dimethyl-2,4-dioxohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.046g/cm3 |
|---|---|
| Boiling Point | 68ºC (0.5 torr) |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23200 |
| Flash Point | 106.7ºC |
| Exact Mass | 200.10500 |
| PSA | 60.44000 |
| LogP | 1.12390 |
| Vapour Pressure | 4.06E-05mmHg at 25°C |
| Index of Refraction | 1.47 |
| InChIKey | NIMKIMUBJFWPTD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C(C)(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S24/25 |
| HS Code | 2918300090 |
|
~93%
5,5-Dimethyl-2,... CAS#:13395-36-3 |
| Literature: Parlow, John J.; Mischke, Deborah A.; Woodard, Scott S. Journal of Organic Chemistry, 1997 , vol. 62, # 17 p. 5908 - 5919 |
|
~10%
Detail
|
| Literature: Bayer Aktiengesellschaft Patent: US4739104 A1, 1988 ; |
|
~%
5,5-Dimethyl-2,... CAS#:13395-36-3 |
| Literature: Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, , vol. 150, p. 928 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00052319 |
| Ethyl trimethylacetopyruvate |
| EINECS 236-478-4 |
| ethyl 5,5-dimethyl-2,4-dioxohexanoate |