(S)-2-[(R)-(2,3,4,5,6-pentafluorophenoxy)phenoxyphosphorylamino]propionic acid isopropyl ester structure
|
Common Name | (S)-2-[(R)-(2,3,4,5,6-pentafluorophenoxy)phenoxyphosphorylamino]propionic acid isopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 1337529-56-2 | Molecular Weight | 453.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17F5NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-2-[(R)-(2,3,4,5,6-pentafluorophenoxy)phenoxyphosphorylamino]propionic acid isopropyl esterIsopropyl ((R)-(perfluorophenoxy)(phenoxy)phosphoryl)-L-alaninate can be used to synthesis Sofosbuvir (HY-15005) to avoid the production of sofibuvir degradation impurities[1]. |
| Name | (S)-2-[(R)-(2,3,4,5,6-pentafluorophenoxy)phenoxyphosphorylamino]propionic acid isopropyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Isopropyl ((R)-(perfluorophenoxy)(phenoxy)phosphoryl)-L-alaninate can be used to synthesis Sofosbuvir (HY-15005) to avoid the production of sofibuvir degradation impurities[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Shi GH, et al. The preparation of Suo Feibuwei. CN109535213A. |
| Molecular Formula | C18H17F5NO5P |
|---|---|
| Molecular Weight | 453.29700 |
| Exact Mass | 453.07600 |
| PSA | 83.67000 |
| LogP | 5.26860 |
| InChIKey | MIILDBHEJQLACD-PAUNIHGJSA-N |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| .(S)-isopropyl 2-(((S)-(perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate |
| .(S)-isopropyl-2-(((R)-(perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate |
| .2(S)-[((R)-2,3,4,5,6-pentafluoro-phenoxy)-phenoxy-phosphorylamino]propionic acid isopropyl ester |
| .(S)-isopropyl 2-(((R)-(perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate |
| propan-2-yl (2S)-2-[[(R)-pentafluorophenoxy(phenoxy)phosphoryl]amino]propanoate |