2-chloro-9h-purin-6-ol structure
|
Common Name | 2-chloro-9h-purin-6-ol | ||
|---|---|---|---|---|
| CAS Number | 13368-14-4 | Molecular Weight | 170.557 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 478.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C5H3ClN4O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 243.2±23.7 °C | |
| Name | 2-chloro-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.6±27.0 °C at 760 mmHg |
| Molecular Formula | C5H3ClN4O |
| Molecular Weight | 170.557 |
| Flash Point | 243.2±23.7 °C |
| Exact Mass | 169.999542 |
| PSA | 74.69000 |
| LogP | -0.24 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.808 |
| InChIKey | WIEATFFSFYPBQD-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(Cl)nc2nc[nH]c12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
2-chloro-9h-pur... CAS#:13368-14-4 |
| Literature: Journal of the American Chemical Society, , vol. 79, p. 2185,2188 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-CHLORO-6-HYDROXYPURINE |
| 2-Chlorohypoxanthine |
| 2-chloro-7H-purin-6-ol |
| 2-chloro-9h-purin-6-ol |
| 6-Hydroxy-2-chlorpurin |
| 2-Chloro-1,7-dihydro-6H-purin-6-one |
| 2-Chloro-1H-purin-6(7H)-one |
| 2-Chlor-6-hydroxy-purin |
| 2-chloro-1,7(9)-dihydro-purin-6-one |
| 6H-Purin-6-one, 2-chloro-1,7-dihydro- |
| 7H-Purin-6-ol, 2-chloro- |
| 9H-purin-6-ol, 2-chloro- |