3-(4-Bromo-3-chlorophenyl)-1-methoxy-1-methylurea structure
|
Common Name | 3-(4-Bromo-3-chlorophenyl)-1-methoxy-1-methylurea | ||
|---|---|---|---|---|
| CAS Number | 13360-45-7 | Molecular Weight | 293.545 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10BrClN2O2 | Melting Point | 95-97℃ | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | chlorbromuron |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 95-97℃ |
| Molecular Formula | C9H10BrClN2O2 |
| Molecular Weight | 293.545 |
| Exact Mass | 291.961395 |
| PSA | 41.57000 |
| LogP | 3.26 |
| Index of Refraction | 1.616 |
| InChIKey | NLYNUTMZTCLNOO-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)Nc1ccc(Br)c(Cl)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H332 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| RTECS | YS2800000 |
| HS Code | 2928000032 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000032 |
|---|---|
| Summary | 2928000032 3-(4-bromo-3-chlorophenyl)-1-methoxy-1-methylurea。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
[On the determination of chlorpropham, metobromuron and chlorbromuron residues in drugs of the 2. AB-DDR (author's transl)].
Pharmazie 37(5) , 370-4, (1982) A method for analyzing drugs of the 2. AB-DDR for residues of chlorpropham, metobromuron and chlorbromuron is proposed. It is based on the detection of aniline derivatives resulting from alkaline hydr... |
|
|
[Thin-layer chromatographic testing of drugs of the East German Pharmacopoeia, 2d edition, metobromuron and chlorbromuron residues].
Pharmazie 36(4) , 304, (1981)
|
|
|
[Gas chromatographic determination of chlorpropham, metobromuron and chlorbromuron residues in drugs of the East German Pharmacopoeia, 2d edition].
Pharmazie 36(5) , 386-7, (1981)
|
| N’-(4-bromo-3-chlorophenyl)-N-methoxy-N-methylurea |
| EINECS 236-411-9 |
| 3-(4-Bromo-3-chlorophenyl)-1-methoxy-1-methylurea |
| MFCD00055474 |
| Chlorbromuron |
| Urea, N'-(4-bromo-3-chlorophenyl)-N-methoxy-N-methyl- |