Fmoc-Lys (biotin-PEG4)-OH
Modify Date: 2025-09-16 10:17:02
Fmoc-Lys (biotin-PEG4)-OH structure
|
Common Name | Fmoc-Lys (biotin-PEG4)-OH | ||
|---|---|---|---|---|
| CAS Number | 1334172-64-3 | Molecular Weight | 842.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H59N5O11S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Lys (biotin-PEG4)-OHFmoc-Lys (biotin-PEG4)-OH is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Fmoc-Lys (biotin-PEG4)-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Lys (biotin-PEG4)-OH is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C42H59N5O11S |
|---|---|
| Molecular Weight | 842.01 |
| InChIKey | PNYHBAKBBQCIDX-KQICPCTDSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCOCCOCCC(=O)NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| MFCD21363320 |