phenyl 3,5-dichloro-2-hydroxybenzoate structure
|
Common Name | phenyl 3,5-dichloro-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 13340-60-8 | Molecular Weight | 283.10700 | |
| Density | 1.45g/cm3 | Boiling Point | 389.2ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | phenyl 3,5-dichloro-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 389.2ºC at 760 mmHg |
| Molecular Formula | C13H8Cl2O3 |
| Molecular Weight | 283.10700 |
| Flash Point | 189.2ºC |
| Exact Mass | 281.98500 |
| PSA | 46.53000 |
| LogP | 3.91820 |
| Vapour Pressure | 1.29E-06mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | PLIHAXTUDAJMFQ-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c1cc(Cl)cc(Cl)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3,5-Dichlor-2-hydroxy-benzoesaeure-phenylester |
| 3,5-Dichlorosalicylic acid phenyl ester |
| Salicylic acid,3,5-dichloro-,phenyl ester |
| Fenylester kyseliny 3,5-dichlorsalicylove [Czech] |
| 3.5-Dichlor-salicylsaeure-phenylester |
| 3,5-dichloro-2-hydroxy-benzoic acid phenyl ester |
| phenyl-3,5-dichlorosalicylate |
| Benzoic acid,3,5-dichloro-2-hydroxy-,phenyl ester |
| Dichlorsalol |