Landiolol
Landiolol structure
|
Common Name | Landiolol | ||
|---|---|---|---|---|
| CAS Number | 133242-30-5 | Molecular Weight | 509.592 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 727.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C25H39N3O8 | Melting Point | 125.4ºC | |
| MSDS | N/A | Flash Point | 393.8±32.9 °C | |
| Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 3-[4-[(2S)-2-hydroxy-3-[2-(morpholine-4-carbonylamino)ethylamino]propoxy]phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 727.5±60.0 °C at 760 mmHg |
| Melting Point | 125.4ºC |
| Molecular Formula | C25H39N3O8 |
| Molecular Weight | 509.592 |
| Flash Point | 393.8±32.9 °C |
| Exact Mass | 509.273712 |
| PSA | 127.82000 |
| LogP | 0.80 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | WMDSZGFJQKSLLH-RBBKRZOGSA-N |
| SMILES | CC1(C)OCC(COC(=O)CCc2ccc(OCC(O)CNCCNC(=O)N3CCOCC3)cc2)O1 |
|
~72%
Landiolol CAS#:133242-30-5 |
| Literature: EP2687521 A1, ; Paragraph 0045; 0046; 0047; 0048; 0049; 0050 ; |
|
~65%
Landiolol CAS#:133242-30-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 6 p. 1462 - 1469 |
|
~%
Landiolol CAS#:133242-30-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 6 p. 1462 - 1469 |
|
~%
Landiolol CAS#:133242-30-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 6 p. 1462 - 1469 |
|
~%
Landiolol CAS#:133242-30-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 6 p. 1462 - 1469 |
|
~%
Landiolol CAS#:133242-30-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 6 p. 1462 - 1469 |
![4-Hydroxybenzenepropanoic acid [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester structure](https://image.chemsrc.com/caspic/155/144256-11-1.png)
![[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate structure](https://image.chemsrc.com/caspic/168/23735-43-5.png)
CAS#:144481-98-1| [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 3-{4-[(2S)-2-hydroxy-3-[(2-{[(morpholin-4-yl)carbonyl]amino}ethyl)amino]propoxy]phenyl}propanoate |
| (S)-(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 3-(4-hydroxyphenyl)propanoate |
| [(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]methyl 3-{4-[(2S)-2-hydroxy-3-({2-[(4-morpholinylcarbonyl)amino]ethyl}amino)propoxy]phenyl}propanoate |
| [(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]methyl 3-(4-{[(2S)-2-hydroxy-3-({2-[(morpholin-4-ylcarbonyl)amino]ethyl}amino)propyl]oxy}phenyl)propanoate |
| ((S)-2,2-dimethyl-1,3-dioxolan-4-yl)methyl 3-(4-((S)-2-hydroxy-3-(2-(morpholine-4-carboxamido)ethylamino)propoxy)phenyl)propanoate |
| ((4S)-2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 3-(4-(((2S)-2-Hydroxy-3-((2-((morpholin-4-ylcarbonyl)amino)ethyl)amino)propyl)oxy)phenyl)propanoate |
| Benzenepropanoic acid, 4-[(2S)-2-hydroxy-3-[[2-[(4-morpholinylcarbonyl)amino]ethyl]amino]propoxy]-, [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl ester |
| Landiolol |
| 2,2-dimethyl-1,3-dioxolan-4S-ylmethyl 3-(4-hydroxyphenyl)propionate |
| 2,2-dimethyl-1,3-dioxolan-4S-ylmethyl 3-(4-{3-[2-(morpholinocarbonylamino)ethylamino]-2S-hydroxypropoxy}phenyl)propionate |