N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester-d5 structure
|
Common Name | N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester-d5 | ||
|---|---|---|---|---|
| CAS Number | 1331889-45-2 | Molecular Weight | 357.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15D5N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester-d5N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester-d5 is the deuterium labeled N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester[1]. |
| Name | N-Acetyl-S-[3-acetamino-6-hydroxphenyl]cysteine-d5 Allyl Ester |
|---|---|
| Synonym | More Synonyms |
| Description | N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester-d5 is the deuterium labeled N-Acetyl-S-[3-acetamino-6-hydroxphenyl]-cysteine allyl ester[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[59]. |
| References |
| Molecular Formula | C16H15D5N2O5S |
|---|---|
| Molecular Weight | 357.44 |
| Exact Mass | 357.14100 |
| PSA | 137.01000 |
| LogP | 3.16640 |
| InChIKey | DPOLTMPLLWYRSB-ZMPJHPQOSA-N |
| SMILES | C=CCOC(=O)C(CSc1cc(NC(C)=O)ccc1O)NC(C)=O |
| Storage condition | 2-8°C |
| prop-2-enyl (2R)-2-acetamido-3-[2,4-dideuterio-6-hydroxy-3-[(2,2,2-trideuterioacetyl)amino]phenyl]sulfanylpropanoate |