N-(2-amino-4-trifluoromethylphenyl)pyrrolidine structure
|
Common Name | N-(2-amino-4-trifluoromethylphenyl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 133184-80-2 | Molecular Weight | 230.23000 | |
| Density | 1.28g/cm3 | Boiling Point | 315.4ºC at 760mmHg | |
| Molecular Formula | C11H13F3N2 | Melting Point | 33 °C | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | 2-pyrrolidin-1-yl-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 315.4ºC at 760mmHg |
| Melting Point | 33 °C |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23000 |
| Flash Point | 144.5ºC |
| Exact Mass | 230.10300 |
| PSA | 29.26000 |
| LogP | 3.53400 |
| Vapour Pressure | 0.00022mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | HPDFKXPVMXSXGE-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)ccc1N1CCCC1 |
|
~99%
N-(2-amino-4-tr... CAS#:133184-80-2 |
| Literature: HAGIWARA, Masatoshi Patent: EP1712242 A1, 2006 ; Location in patent: Page/Page column 33 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(2-Amino-4-trifluoromethylphenyl)pyrrolidine |
| 1-[2-amino-4-(trifluoromethyl)phenyl]pyrrolidine |
| MFCD00042162 |
| 2-(1-Pyrrolidinyl)-5-(trifluoromethyl)aniline |
| 2-(pyrrolidin-1-yl)-5-(trifluoromethyl)aniline |
| 3-amino-4-(1-pyrrolidino)benzotrifluoride |
| 2-Pyrrolidin-1-yl-5-trifluoromethyl-phenylamine |
| 2-pyrrolidinyl-5-(trifluoromethyl)phenylamine |