KFM19 structure
|
Common Name | KFM19 | ||
|---|---|---|---|---|
| CAS Number | 133058-72-7 | Molecular Weight | 318.37100 | |
| Density | 1.268g/cm3 | Boiling Point | 584.7ºC at 760mmHg | |
| Molecular Formula | C16H22N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.4ºC | |
Use of KFM19KFM19 is a potent, selective Adenosine receptor (A1-receptor) antagonist, with an IC50 of 50 nM. |
| Name | 8-(3-oxocyclopentyl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Description | KFM19 is a potent, selective Adenosine receptor (A1-receptor) antagonist, with an IC50 of 50 nM. |
|---|---|
| Related Catalog | |
| Target |
IC50: 50 nM (Adenosine receptor)[1] |
| References |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 584.7ºC at 760mmHg |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.37100 |
| Flash Point | 307.4ºC |
| Exact Mass | 318.16900 |
| PSA | 89.75000 |
| LogP | 1.54290 |
| Vapour Pressure | 1.18E-13mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | RUHGOZFOVBMWOO-UHFFFAOYSA-N |
| SMILES | CCCn1c(=O)c2[nH]c(C3CCC(=O)C3)nc2n(CCC)c1=O |
| Storage condition | 2-8℃ |
| (+,-)-8-(3-oxocyclopentyl)-1,3-dipropylxanthine |
| 8-(3-oxocyclopentyl)-1,3-di-n-propyl-7H-purine-2,6-dione |
| Biip 20 |
| 1,3-dipropyl-8-(3-oxocyclopentyl)-xanthine |
| ((S)-(-)-8-(3-Oxocyclopentyl)-1,3-dipropyl-7H-purine-2,6-dione) |
| Kfm 19 |
| 8-(3-Oxo-cyclopentyl)-1,3-dipropyl-3,7-dihydro-purine-2,6-dione |
| KFM19 |