2,3-dichloro-6-nitrobenzoic acid structure
|
Common Name | 2,3-dichloro-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 13300-62-4 | Molecular Weight | 236.00900 | |
| Density | 1.713g/cm3 | Boiling Point | 369.1ºC at 760mmHg | |
| Molecular Formula | C7H3Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | 2,3-dichloro-6-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.713g/cm3 |
|---|---|
| Boiling Point | 369.1ºC at 760mmHg |
| Molecular Formula | C7H3Cl2NO4 |
| Molecular Weight | 236.00900 |
| Flash Point | 177ºC |
| Exact Mass | 234.94400 |
| PSA | 83.12000 |
| LogP | 3.12300 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | MWFKWTVYKGMWEH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c([N+](=O)[O-])ccc(Cl)c1Cl |
|
~%
2,3-dichloro-6-... CAS#:13300-62-4 |
| Literature: US2005/250820 A1, ; Page/Page column 71 ; US 20050250820 A1 |
|
~%
2,3-dichloro-6-... CAS#:13300-62-4 |
| Literature: EP373531 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2,3-dichloro-6-nitro |
| 2,3-Dichloro-6-nitrobenzoicacid |