2,6-diethyl spiro[3.3]heptane-2,6-dicarboxylate structure
|
Common Name | 2,6-diethyl spiro[3.3]heptane-2,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 132616-34-3 | Molecular Weight | 240.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Spiro[3.3]heptane-2,6-dicarboxylic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20O4 |
|---|---|
| Molecular Weight | 240.29500 |
| Exact Mass | 240.13600 |
| PSA | 52.60000 |
| LogP | 1.91900 |
| InChIKey | GNJWXXQQMIJNDT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2(C1)CC(C(=O)OCC)C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917209090 |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| diethyl spiro[3.3]heptane-2,6-dicarboxylate |