4-Ethoxy-3-nitrobenzaldehyde
Modify Date: 2025-08-25 18:30:56
4-Ethoxy-3-nitrobenzaldehyde structure
|
Common Name | 4-Ethoxy-3-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 132390-61-5 | Molecular Weight | 195.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO4 | Melting Point | 59-63ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Ethoxy-3-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 59-63ºC(lit.) |
|---|---|
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Exact Mass | 195.05300 |
| PSA | 72.12000 |
| LogP | 2.32920 |
| InChIKey | RPJKVMCCDKVUJN-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C=O)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 4-ethoxy-3-nitro-benzaldehyde |
| 4-ETHOXY-3-NITROBENZALDEHYDE 97 |
| 4-Aethoxy-3-nitro-benzaldehyd |