2-(4-Methoxybenzamido)acetic acid structure
|
Common Name | 2-(4-Methoxybenzamido)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 13214-64-7 | Molecular Weight | 209.199 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 463.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | 155-158ºC | |
| MSDS | N/A | Flash Point | 234.3±24.6 °C | |
| Name | 2-(4-Methoxybenzamido)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.7±30.0 °C at 760 mmHg |
| Melting Point | 155-158ºC |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.199 |
| Flash Point | 234.3±24.6 °C |
| Exact Mass | 209.068802 |
| PSA | 75.63000 |
| LogP | 0.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | SIEIOUWSTGWJGE-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NCC(=O)O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(4-methoxybenzoyl)amino]acetic acid |
| Glycine, N-(4-methoxybenzoyl)- |
| N-(4-Methoxybenzoyl)glycine |