Boc-L-3-cyanophenylalanine structure
|
Common Name | Boc-L-3-cyanophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 131980-30-8 | Molecular Weight | 290.314 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 485.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2O4 | Melting Point | 124.1 °C | |
| MSDS | Chinese USA | Flash Point | 247.4±27.3 °C | |
| Name | Boc-L-3-cyanophenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.4±40.0 °C at 760 mmHg |
| Melting Point | 124.1 °C |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.314 |
| Flash Point | 247.4±27.3 °C |
| Exact Mass | 290.126648 |
| PSA | 99.42000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | FDQDHMZKOPOWFE-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cccc(C#N)c1)C(=O)O |
| Storage condition | Store at 0°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~85%
Boc-L-3-cyanoph... CAS#:131980-30-8 |
| Literature: WILEX AG Patent: WO2006/42678 A1, 2006 ; Location in patent: Page/Page column 12 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2S)-3-(3-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| (2S)-3-(3-Cyanophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| N-(tert-Butoxycarbonyl)-3-cyan-L-phenylalanin |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-(3-cyanophenyl)propanoic acid |
| 3-Cyano-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| L-Phenylalanine, 3-cyano-N-[(1,1-dimethylethoxy)carbonyl]- |
| MFCD00797560 |
| (S)-N-BOC-3-Cyanophenylalanine |
| N-(tert-Butoxycarbonyl)-3-cyano-L-phenylalanine |
| Boc-Phe(3-CN)-OH |