Ala-Glu-OH structure
|
Common Name | Ala-Glu-OH | ||
|---|---|---|---|---|
| CAS Number | 13187-90-1 | Molecular Weight | 218.21 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 520.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.6±30.1 °C | |
Use of Ala-Glu-OHAla-Glu-OH is an agent of the dipeptide[1][2]. |
| Name | L-alanyl-L-glutamic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ala-Glu-OH is an agent of the dipeptide[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.5±50.0 °C at 760 mmHg |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 |
| Flash Point | 268.6±30.1 °C |
| Exact Mass | 218.090271 |
| PSA | 129.72000 |
| LogP | -2.33 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | VYZAGTDAHUIRQA-WHFBIAKZSA-N |
| SMILES | CC(N)C(=O)NC(CCC(=O)O)C(=O)O |
| Storage condition | -15°C |
| HS Code | 2924199090 |
|---|
|
~%
Ala-Glu-OH CAS#:13187-90-1 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 4608 |
|
~%
Ala-Glu-OH CAS#:13187-90-1 |
| Literature: Agricultural and Biological Chemistry, , vol. 52, # 3 p. 871 - 872 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Alanyl=>L-glutaminsaeure |
| N-L-Alanyl-L-glutaminsaeure |
| alanylglutamate |
| N-L-Alanyl-L-glutamic acid |
| L-Glutamic acid, L-alanyl- |
| L-alanyl-glutamic acid |
| Ala-Glu-OH |
| L-Alanyl-L-glutamic acid |
| ALA-GLU |
| ALANINE GLUTAMATE |
| H-Ala-Glu-OH |
| Alanylglutamic acid |
| L-Ala-L-Glu-OH |