Fructosazine structure
|
Common Name | Fructosazine | ||
|---|---|---|---|---|
| CAS Number | 13185-73-4 | Molecular Weight | 320.29600 | |
| Density | 1.68g/cm3 | Boiling Point | 764.9ºC at 760mmHg | |
| Molecular Formula | C12H20N2O8 | Melting Point | >150°C (dec.) (lit.) | |
| MSDS | N/A | Flash Point | 416.4ºC | |
| Name | (1R,2S,3R)-1-[5-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]pyrazin-2-yl]butane-1,2,3,4-tetrol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 764.9ºC at 760mmHg |
| Melting Point | >150°C (dec.) (lit.) |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.29600 |
| Flash Point | 416.4ºC |
| Exact Mass | 320.12200 |
| PSA | 187.62000 |
| Vapour Pressure | 1.34E-24mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | NPWQIVOYGNUVEB-PAUJSFGCSA-N |
| SMILES | OCC(O)C(O)C(O)c1cnc(C(O)C(O)C(O)CO)cn1 |
| Storage condition | 20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933990090 |
|
~19%
Fructosazine CAS#:13185-73-4 |
| Literature: ROTTAPHARM S.P.A. Patent: EP1704862 A1, 2006 ; Location in patent: Page/Page column 10 ; |
|
~%
Fructosazine CAS#:13185-73-4 |
| Literature: Carbohydrate Research, , vol. 184, p. 67 - 76 |
|
~47%
Fructosazine CAS#:13185-73-4 |
| Literature: Sumoto; Irie; Mibu; Miyano; Nakashima; Watanabe; Yamaguchi Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 3 p. 792 - 794 |
|
~%
Fructosazine CAS#:13185-73-4 |
| Literature: Bioscience, Biotechnology and Biochemistry, , vol. 67, # 2 p. 295 - 299 |
|
~%
Fructosazine CAS#:13185-73-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 3 p. 792 - 794 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Fructosazine |
| 2,5-bis(D-Arabinotetrahydroxybutyl)pyrazine |
| bis-(1R,1'R,2S,2'S,3R,3'R)-1,2,3,4-butanetetrol-1,1'-(2,5-pyrazinediyl) |
| 1,2,3,4-Butanetetrol,1,1'-(2,5-pyrazinediyl)bis-,(1R-(1R*,1'*,2S*,2'S*,3R,3R*)) |
| 2,5-bis-(Dr-1tF,2cF,3rF,4-tetrahydroxy-but-catF-yl)-pyrazine |
| 2,5-Bis-(Dr-1tF,2cF,3rF,4-tetrahydroxy-but-catF-yl)-pyrazin |
| fructosazine |
| 2,5-bis(tetrahydroxybutyl)pyrazine |