MDL 27399
Modify Date: 2025-09-27 00:32:17
MDL 27399 structure
|
Common Name | MDL 27399 | ||
|---|---|---|---|---|
| CAS Number | 131374-22-6 | Molecular Weight | 532.58600 | |
| Density | 1.239g/cm3 | Boiling Point | 840.6ºC at 760mmHg | |
| Molecular Formula | C26H36N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 462.2ºC | |
Use of MDL 27399MDL 27399 is an inhibitor of human neutrophil cathepsin G (Ki = 7 μM). MDL 27399 can be used for research of inflammatory diseases[1]. |
| Name | methyl 4-[[(2S)-1-[[(2S)-1-[(2S)-2-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | MDL 27399 is an inhibitor of human neutrophil cathepsin G (Ki = 7 μM). MDL 27399 can be used for research of inflammatory diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 840.6ºC at 760mmHg |
| Molecular Formula | C26H36N4O8 |
| Molecular Weight | 532.58600 |
| Flash Point | 462.2ºC |
| Exact Mass | 532.25300 |
| PSA | 170.68000 |
| LogP | 2.29930 |
| Vapour Pressure | 1.76E-28mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | IHIOQWRKKWYCIQ-ZULIPRJHSA-N |
| SMILES | COC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)OC |
| Meo-succ-ala-ala-pro-phe-cooch3 |
| Mdl 27,399 |