Wittifuran X
Modify Date: 2025-08-25 07:42:20
Wittifuran X structure
|
Common Name | Wittifuran X | ||
|---|---|---|---|---|
| CAS Number | 1309478-07-6 | Molecular Weight | 272.25 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 392.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.1±25.1 °C | |
Use of Wittifuran XWittifuran X is a 2-arylbenzofuran derivative, which can be isolated from the stem bark of Morus wittiorum[1]. |
| Name | Wittifuran X |
|---|---|
| Synonym | More Synonyms |
| Description | Wittifuran X is a 2-arylbenzofuran derivative, which can be isolated from the stem bark of Morus wittiorum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.4±32.0 °C at 760 mmHg |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25 |
| Flash Point | 191.1±25.1 °C |
| Exact Mass | 272.068481 |
| PSA | 83.06000 |
| LogP | 2.07 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | STYZEEPLURADAI-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(-c3cc(O)cc(O)c3)oc2cc1O |
| Hazard Codes | Xi |
|---|
| 5-(6-Hydroxy-5-methoxy-1-benzofuran-2-yl)-1,3-benzenediol |
| 1,3-Benzenediol, 5-(6-hydroxy-5-methoxy-2-benzofuranyl)- |