Scoparil structure
|
Common Name | Scoparil | ||
|---|---|---|---|---|
| CAS Number | 130838-00-5 | Molecular Weight | 426.588 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 544.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C27H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.8±18.1 °C | |
Use of ScoparilScoparinol (Scopadiol) is a diterpene isolated from Scoparia dulcis that has significant analgesic and anti-inflammatory activities[1]. |
| Name | (1R,4S,4aR,8R,8aR)-8-(Hydroxymethyl)-4-[(3E)-5-hydroxy-3-methyl-3 -penten-1-yl]-4a,8-dimethyl-3-methylenedecahydro-1-naphthalenyl b enzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Scoparinol (Scopadiol) is a diterpene isolated from Scoparia dulcis that has significant analgesic and anti-inflammatory activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.3±30.0 °C at 760 mmHg |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.588 |
| Flash Point | 173.8±18.1 °C |
| Exact Mass | 426.277008 |
| PSA | 66.76000 |
| LogP | 6.57 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | WGSYIFPPMZUQAN-WAUMKTBASA-N |
| SMILES | C=C1CC(OC(=O)c2ccccc2)C2C(C)(CO)CCCC2(C)C1CCC(C)=CCO |
| Hazard Codes | Xi |
|---|
| (1R,4S,4aR,8R,8aR)-8-(Hydroxymethyl)-4-[(3E)-5-hydroxy-3-methyl-3-penten-1-yl]-4a,8-dimethyl-3-methylenedecahydro-1-naphthalenyl benzoate |
| 1-Naphthalenemethanol, 8-(benzoyloxy)decahydro-5-[(3E)-5-hydroxy-3-methyl-3-penten-1-yl]-1,4a-dimethyl-6-methylene-, (1R,4aR,5S,8R,8aR)- |