Nifekalant Hydrochloride
Nifekalant Hydrochloride structure
|
Common Name | Nifekalant Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 130636-43-0 | Molecular Weight | 441.909 | |
| Density | 1.32 g/cm3 | Boiling Point | 597.9ºC at 760 mmHg | |
| Molecular Formula | C19H28ClN5O5 | Melting Point | 117.5-118.5ºC | |
| MSDS | N/A | Flash Point | 315.4ºC | |
| Name | Nifekalant |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 g/cm3 |
|---|---|
| Boiling Point | 597.9ºC at 760 mmHg |
| Melting Point | 117.5-118.5ºC |
| Molecular Formula | C19H28ClN5O5 |
| Molecular Weight | 441.909 |
| Flash Point | 315.4ºC |
| Exact Mass | 441.177887 |
| PSA | 125.32000 |
| LogP | 1.72940 |
| Vapour Pressure | 3.84E-15mmHg at 25°C |
| InChIKey | OEBPANQZQGQPHF-UHFFFAOYSA-N |
| SMILES | Cn1c(NCCN(CCO)CCCc2ccc([N+](=O)[O-])cc2)cc(=O)n(C)c1=O |
|
~%
Nifekalant Hydr... CAS#:130636-43-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 18 p. 3325 - 3330 |
|
~%
Nifekalant Hydr... CAS#:130636-43-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 18 p. 3325 - 3330 |
|
~%
Nifekalant Hydr... CAS#:130636-43-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 18 p. 3325 - 3330 |
|
~%
Nifekalant Hydr... CAS#:130636-43-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 18 p. 3325 - 3330 |
|
~%
Nifekalant Hydr... CAS#:130636-43-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 18 p. 3325 - 3330 |
![6-[N-(2-Hydroxyethyl)amino]-1,3-dimethyl-2,4(1H,3H)-dione structure](https://image.chemsrc.com/caspic/034/5770-44-5.png)
![2-{[3-(4-Nitrophenyl)propyl]amino}ethanol structure](https://image.chemsrc.com/caspic/198/130634-09-2.png)
| 6-[2-[2-hydroxyethyl-[3-(4-nitrophenyl)propyl]amino]ethylamino]-1,3-dimethyl-pyrimidine-2,4-quinone |
| 6-[(2-{(2-Hydroxyethyl)[3-(4-nitrophenyl)propyl]amino}ethyl)amino]-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione hydrochloride (1:1) |
| NIFEKALANT [6-((2-((2-HYDROXYETHYL)(3-(P-NITROPHENYL)PROPYL)AMINO)ETHYL)AMINO)-1,3-DIMETHYL-URACIL] |
| 1,3-dimethyl-6-{2-{N-(2-hydroxyethyl)-N-[3-(4-nitrophenyl) propyl]amino}ethylamino}-2,4-(1H,3H)-pyrimidinedione |
| 1,3-dimethyl-6-[2-(n-(2-hydroxyethyl)-3-(4-nitrophenyl)propylamino)ethylamino]-2,4(1h,3h)-pyrimidinedione hydrochloride |
| Nifekalant HCl |
| 6-[2-[2-hydroxyethyl-[3-(4-nitrophenyl)propyl]amino]ethylamino]-1,3-dimethyl-pyrimidine-2,4-dione |
| Shinbit |
| MFCD00892243 |
| 6-((2-((2-hydroxyethyl)(3-(p-nitrophenyl)propyl)amino)ethyl)amino)-1,3-dimethyl-uracil |
| 2,4(1H,3H)-Pyrimidinedione, 6-[[2-[(2-hydroxyethyl)[3-(4-nitrophenyl)propyl]amino]ethyl]amino]-1,3-dimethyl-, hydrochloride (1:1) |
| 1,3-dimethyl-6-{2-[N-(2-hydroxyethyl)-3-(4-nitrophenyl)propylamino]ethylamino}-2,4(1H,3H)-pyrimidinedione |
| Nifekalant Hydrochloride |
| 6-[(2-{(2-Hydroxyethyl)[3-(4-nitrophenyl)propyl]amino}ethyl)amino]-1,3-dimethylpyrimidine-2,4(1H,3H)-dione hydrochloride (1:1) |
| 1,3-dimethyl-6-<<2-<N-<3-(4-nitrophenyl)-propyl>-N-(hydroxyethyl)amino>ethyl>amino>-2,4(1H,3H)-pyrimidinedione |