METHYL 5-(2-PHENYLETH-1-YNYL)-2-FUROATE structure
|
Common Name | METHYL 5-(2-PHENYLETH-1-YNYL)-2-FUROATE | ||
|---|---|---|---|---|
| CAS Number | 130423-85-7 | Molecular Weight | 226.22700 | |
| Density | 1.22g/cm3 | Boiling Point | 373.3ºC at 760 mmHg | |
| Molecular Formula | C14H10O3 | Melting Point | 79ºC | |
| MSDS | N/A | Flash Point | 179.6ºC | |
| Name | methyl 5-(2-phenylethynyl)furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 373.3ºC at 760 mmHg |
| Melting Point | 79ºC |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.22700 |
| Flash Point | 179.6ºC |
| Exact Mass | 226.06300 |
| PSA | 39.44000 |
| LogP | 2.46600 |
| Vapour Pressure | 9.03E-06mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | XBGYVGZZCQDFDV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C#Cc2ccccc2)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| methyl 5-(2-phenyleth-1-ynyl)-2-furoate |
| 2-Furancarboxylic acid,5-(2-phenylethynyl)-,methyl ester |