1-[4-(2-phenyleth-1-ynyl)phenyl]ethan-1-one structure
|
Common Name | 1-[4-(2-phenyleth-1-ynyl)phenyl]ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 1942-31-0 | Molecular Weight | 220.26600 | |
| Density | 1.12g/cm3 | Boiling Point | 377.2ºC at 760mmHg | |
| Molecular Formula | C16H12O | Melting Point | 99 °C | |
| MSDS | USA | Flash Point | 165.3ºC | |
| Name | 1-[4-(2-phenylethynyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 377.2ºC at 760mmHg |
| Melting Point | 99 °C |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.26600 |
| Flash Point | 165.3ºC |
| Exact Mass | 220.08900 |
| PSA | 17.07000 |
| LogP | 3.28900 |
| Vapour Pressure | 6.84E-06mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | QCYZMMVPXNWSJK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C#Cc2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2914399090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-acetyl-4-(2-phenylethynyl)benzene |
| 4-(1-oxoethyl)-1-(phenylethynyl)benzene |
| 4-(2-phenylethynyl)acetophenone |
| 1-(4-acetylphenyl)-2-phenylethyne |
| 1-(4-(2-phenylethynyl)phenyl)ethanone |
| MFCD00219774 |
| 1-(4-(2-phenylethynyl)phenyl)ethan-1-one |
| 1-[4-(2-phenyleth-1-ynyl)phenyl]ethan-1-one |
| 4-acetylphenyl(phenyl)acetylene |