butane-1,4-diyl diacetoacetate structure
|
Common Name | butane-1,4-diyl diacetoacetate | ||
|---|---|---|---|---|
| CAS Number | 13018-41-2 | Molecular Weight | 258.26800 | |
| Density | 1.133g/cm3 | Boiling Point | 371.4ºC at 760mmHg | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | 4-(3-oxobutanoyloxy)butyl 3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 371.4ºC at 760mmHg |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Flash Point | 163.2ºC |
| Exact Mass | 258.11000 |
| PSA | 86.74000 |
| LogP | 0.81120 |
| Vapour Pressure | 1.04E-05mmHg at 25°C |
| Index of Refraction | 1.45 |
| InChIKey | IHSFHIUGYHMYNR-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OCCCCOC(=O)CC(C)=O |
| HS Code | 2918300090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| butane-1,4-diyl bis(3-oxobutanoate) |
| 1,4-butanediol bisacetoacetate |
| 1,4-bis-acetoacetyloxy-butane |
| 3-oxobutyric acid 4-(3-oxobutyryloxy)butyl ester |
| butane-1,4-diyl diacetoacetate |
| 1,4-Bis-acetoacetyloxy-butan |
| tetramethylene di(3-oxobutanoate) |
| EINECS 235-873-9 |
| 1,4-butanediol diacetoacetate |