(1,10-Phenanthroline)(trifluoromethyl)copper(I)
Modify Date: 2025-08-25 17:08:38
(1,10-Phenanthroline)(trifluoromethyl)copper(I) structure
|
Common Name | (1,10-Phenanthroline)(trifluoromethyl)copper(I) | ||
|---|---|---|---|---|
| CAS Number | 1300746-79-5 | Molecular Weight | 312.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8CuF3N2 | Melting Point | 108-224°C | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | copper(1+),1,10-phenanthroline,trifluoromethane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 108-224°C |
|---|---|
| Molecular Formula | C13H8CuF3N2 |
| Molecular Weight | 312.75700 |
| Exact Mass | 311.99400 |
| PSA | 25.78000 |
| LogP | 4.12240 |
| InChIKey | HFYRAUCEONFIPJ-UHFFFAOYSA-N |
| SMILES | F[C-](F)F.[Cu+].c1cnc2c(c1)ccc1cccnc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312-H315-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
A broadly applicable copper reagent for trifluoromethylations and perfluoroalkylations of aryl iodides and bromides.
Angew. Chem. Int. Ed. Engl. 50 , 3793, (2011)
|
| (1,10-Phenanthroline)(trifluoromethyl)copper(I) |