2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine structure
|
Common Name | 2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 13002-65-8 | Molecular Weight | 371.51500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-[(E)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H29NO |
|---|---|
| Molecular Weight | 371.51500 |
| Exact Mass | 371.22500 |
| PSA | 12.47000 |
| LogP | 5.99610 |
| Index of Refraction | 1.568 |
| InChIKey | NKANXQFJJICGDU-OCEACIFDSA-N |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
| HS Code | 2922299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UPCMLD-DP027:001 |
| cis-Tamoxifen |