I-BOP
Modify Date: 2025-09-13 19:20:26
I-BOP structure
|
Common Name | I-BOP | ||
|---|---|---|---|---|
| CAS Number | 128719-90-4 | Molecular Weight | 512.378 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 634.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H29IO5 | Melting Point | -144.0 °C | |
| MSDS | USA | Flash Point | 337.5±31.5 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of I-BOPI-BOP is a potent thromboxane (TP) receptor agonist. I-BOP induces human platelet aggregation with an EC50 value of 0.34 nM. |
| Name | 7-[(1s,2r,3r,4r)-3-[(1e,3r)-3-hydroxy-4-(4-iodophenoxy)-1-butenyl]-7-oxabicyclo[2.2.1]hept-2-yl]-5z-heptenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 634.5±55.0 °C at 760 mmHg |
| Melting Point | -144.0 °C |
| Molecular Formula | C23H29IO5 |
| Molecular Weight | 512.378 |
| Flash Point | 337.5±31.5 °C |
| Exact Mass | 512.105957 |
| PSA | 75.99000 |
| LogP | 4.56 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | UYFMSCHBODMWON-NOPOPKCCSA-N |
| SMILES | O=C(O)CCCC=CCC1C2CCC(O2)C1C=CC(O)COc1ccc(I)cc1 |
| Storage condition | 20°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H319 |
| Precautionary Statements | P210-P280-P305 + P351 + P338-P337 + P313-P403 + P235 |
| Hazard Codes | F+ |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| i-bop |
| (5Z)-7-{(1S,2R,3R,4R)-3-[(1E,3R)-3-Hydroxy-4-(4-iodophenoxy)-1-buten-1-yl]-7-oxabicyclo[2.2.1]hept-2-yl}-5-heptenoic acid |
| 5-Heptenoic acid, 7-[(1S,2R,3R,4R)-3-[(1E,3R)-3-hydroxy-4-(4-iodophenoxy)-1-buten-1-yl]-7-oxabicyclo[2.2.1]hept-2-yl]-, (5Z)- |