(2s,3r)-3-amino-2-hydroxy-4-phenylbutyric acid hydrochloride structure
|
Common Name | (2s,3r)-3-amino-2-hydroxy-4-phenylbutyric acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 128223-55-2 | Molecular Weight | 231.67600 | |
| Density | N/A | Boiling Point | 428.5ºC at 760mmHg | |
| Molecular Formula | C10H14ClNO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 213ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S,3R)-3-Amino-2-hydroxy-4-phenylbutanoic acid hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 428.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.67600 |
| Flash Point | 213ºC |
| Exact Mass | 231.06600 |
| PSA | 83.55000 |
| LogP | 1.50420 |
| Vapour Pressure | 4.17E-08mmHg at 25°C |
| InChIKey | OPVMPYQFOLATCK-RJUBDTSPSA-N |
| SMILES | Cl.NC(Cc1ccccc1)C(O)C(=O)O |
| Storage condition | −20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26/36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Bestatin analogue from Streptomyces neyagawaensis SL-387.
Biosci. Biotechnol. Biochem. 60 , 898-900, (1996) A bestatin analogue, (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoyl-L-valine (AHPA-Val), from the culture filtrate of Streptomyces neyagawaensis SL-387 was obtained in a chemically defined medium containi... |
|
|
2S,3R 3-amino-2-hydroxy-4-phenylbutanoic acid derivatives, enkephalinase inhibitors, augment met5-enkephalin-induced antinociception.
Jpn. J. Pharmacol. 46 , 205-210, (1988) It has been accepted that the periaqueductal gray matter of the mid brain (PAG) and the reticular formation of the medulla oblongata in the brain stem have antinociceptive roles in the pain control pa... |
|
|
Relationship between enhancement of morphine analgesia and inhibition of enkephalinase by 2S, 3R 3-amino-2-hydroxy-4-phenylbutanoic acid derivatives.
Life Sci. 30 , 1739-1746, (1982) The effects of nineteen AHPA* derivatives were examined on morphine analgesia by tail-flick test in rats and on enkephalinase inhibition which was based on the formation of tyrosyl-glycyl-glycine from... |
| (2S,3R)-3-Amino-2-hydroxy-4-phenylbutyric acid hydrochloride |
| (2S,3R)-3-Amino-2-hydroxy-4-phenyl-butyric acidhydrochloride |
| (2S,3R)-AHPA |