PD 125967
Modify Date: 2025-08-26 15:05:32
PD 125967 structure
|
Common Name | PD 125967 | ||
|---|---|---|---|---|
| CAS Number | 128139-14-0 | Molecular Weight | 814.11 | |
| Density | 1.14g/cm3 | Boiling Point | 1072.1ºC at 760 mmHg | |
| Molecular Formula | C51H67N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 602.2ºC | |
Use of PD 125967PD 125967 is an oligopeptide renin inhibitor. PD125967 can be used to low blood pressure[1]. |
| Name | 6-cyclohexyl-4-hydroxy-5-[[3-(1H-imidazol-5-yl)-2-[[3-naphthalen-1-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]propanoyl]amino]-N-(2-methylbutyl)-2-(2-methylpropyl)hexanamide |
|---|
| Description | PD 125967 is an oligopeptide renin inhibitor. PD125967 can be used to low blood pressure[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 1072.1ºC at 760 mmHg |
| Molecular Formula | C51H67N5O4 |
| Molecular Weight | 814.11 |
| Flash Point | 602.2ºC |
| Exact Mass | 813.51900 |
| PSA | 146.68000 |
| LogP | 11.39670 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | SIGGSNKWBGJQQB-UHFFFAOYSA-N |
| SMILES | CCC(C)CNC(=O)C(CC(C)C)CC(O)C(CC1CCCCC1)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1cccc2ccccc12)Cc1cccc2ccccc12 |