1,5-Dinitro-4,8-dihydroxyanthraquinone structure
|
Common Name | 1,5-Dinitro-4,8-dihydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 128-91-6 | Molecular Weight | 330.206 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 669.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H6N2O8 | Melting Point | 186 °C | |
| MSDS | N/A | Flash Point | 280.8±20.0 °C | |
| Name | 1,5-Dihydroxy-4,8-dinitroanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 669.4±55.0 °C at 760 mmHg |
| Melting Point | 186 °C |
| Molecular Formula | C14H6N2O8 |
| Molecular Weight | 330.206 |
| Flash Point | 280.8±20.0 °C |
| Exact Mass | 330.012421 |
| PSA | 166.24000 |
| LogP | 4.94 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.782 |
| InChIKey | CUIHODIOWPLCMG-UHFFFAOYSA-N |
| SMILES | O=C1c2c(O)ccc([N+](=O)[O-])c2C(=O)c2c(O)ccc([N+](=O)[O-])c21 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2914700090 |
|
~%
1,5-Dinitro-4,8... CAS#:128-91-6 |
| Literature: DE89090 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 314 Chemische Berichte, , vol. 29, p. 2940 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,5-Dinitro-4,8-dihydroxyanthraquinone |
| MFCD00035827 |
| 1,5-Dihydroxy-4,8-dinitro-9,10-anthraquinone |
| 4,8-Dihydroxy-1,5-dinitroanthraquinone |
| 1,5-Dihydroxy-4,8-dinitro-anthraquinone |
| 9,10-Anthracenedione, 1,5-dihydroxy-4,8-dinitro- |
| 1,5-dihydroxy-4,8-dinitroanthraquinone |
| Anthraquinone, 1,5-dihydroxy-4,8-dinitro- |
| EINECS 204-918-4 |
| 4,8-Dinitro-1,5-dihydroxyanthraquinone |