Sporidesmolide V structure
|
Common Name | Sporidesmolide V | ||
|---|---|---|---|---|
| CAS Number | 127072-57-5 | Molecular Weight | 666.88900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H62N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sporidesmolide VSporidesmolide V is a cyclodepsipeptide compound isolated from the cultures of Pithornyces chartarum[1]. |
| Name | sporidesmolide V |
|---|---|
| Synonym | More Synonyms |
| Description | Sporidesmolide V is a cyclodepsipeptide compound isolated from the cultures of Pithornyces chartarum[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C35H62N4O8 |
|---|---|
| Molecular Weight | 666.88900 |
| Exact Mass | 666.45700 |
| PSA | 160.21000 |
| LogP | 4.52570 |
| InChIKey | FUGMHZCDRCPQDM-DFTYQABXSA-N |
| SMILES | CCC(C)C1NC(=O)C(C(C)C)OC(=O)C(CC(C)C)N(C)C(=O)C(C(C)C)NC(=O)C(CC(C)C)OC(=O)C(CC(C)C)NC1=O |
| (3S,6S,12R,15R)-15-((S)-sec-Butyl)-3,9,12-triisobutyl-6,18-diisopropyl-4-methyl-1,10-dioxa-4,7,13,16-tetraaza-cyclooctadecane-2,5,8,11,14,17-hexaone |