(S)-4-(4-(BENZYLOXY)PHENYL)-3-((TERT-BUTOXYCARBONYL)AMINO)BUTANOIC ACID structure
|
Common Name | (S)-4-(4-(BENZYLOXY)PHENYL)-3-((TERT-BUTOXYCARBONYL)AMINO)BUTANOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 126825-16-9 | Molecular Weight | 385.45300 | |
| Density | 1.168g/cm3 | Boiling Point | 567.7ºC at 760 mmHg | |
| Molecular Formula | C22H27NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 297.1ºC | |
| Name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(4-phenylmethoxyphenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 567.7ºC at 760 mmHg |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.45300 |
| Flash Point | 297.1ºC |
| Exact Mass | 385.18900 |
| PSA | 84.86000 |
| LogP | 4.56700 |
| Vapour Pressure | 1E-13mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | HTZSKDKNNZPVMJ-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(OCc2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
|
~91%
(S)-4-(4-(BENZY... CAS#:126825-16-9 |
| Literature: The Procter and Gamble Company Patent: US2003/236230 A1, 2003 ; Location in patent: Page 29; 32-33 ; US 20030236230 A1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-β-Homotyr(Bzl)-OH |
| AmbotzBAA6270 |
| TMBA035 |