PSTAIR structure
|
Common Name | PSTAIR | ||
|---|---|---|---|---|
| CAS Number | 126675-53-4 | Molecular Weight | 1741.99 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C76H132N20O26 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PSTAIRPSTAIR is a monoclonal antibody that recognizes the PSTAIR sequence in Cdc28, PSTAIR can be used as loading control[1]. |
| Name | PSTAIR peptide |
|---|
| Description | PSTAIR is a monoclonal antibody that recognizes the PSTAIR sequence in Cdc28, PSTAIR can be used as loading control[1]. |
|---|---|
| Related Catalog | |
| Target |
CDC28 |
| References |
| Molecular Formula | C76H132N20O26 |
|---|---|
| Molecular Weight | 1741.99 |
| InChIKey | JCXVGSUDEJTPFS-IVBRFITJSA-N |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)C(NC(=O)C(CO)NC(=O)C1CCCN1C(=O)C(NC(=O)CNC(=O)C(N)CCC(=O)O)C(C)C)C(C)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O)C(C)CC |