Ethyl 2-Anilino-1,3-Thiazole-4-Carboxylate structure
|
Common Name | Ethyl 2-Anilino-1,3-Thiazole-4-Carboxylate | ||
|---|---|---|---|---|
| CAS Number | 126533-76-4 | Molecular Weight | 248.301 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 382.6±34.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2±25.7 °C | |
| Name | Ethyl 2-anilino-1,3-thiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.6±34.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.301 |
| Flash Point | 185.2±25.7 °C |
| Exact Mass | 248.061951 |
| PSA | 82.69000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | VTCUMDSDWMYUJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc(Nc2ccccc2)n1 |
|
~67%
Ethyl 2-Anilino... CAS#:126533-76-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 53, # 4 p. 437 - 440 |
|
~%
Ethyl 2-Anilino... CAS#:126533-76-4 |
| Literature: US4933355 A1, ; |
|
~%
Ethyl 2-Anilino... CAS#:126533-76-4 |
| Literature: US4933355 A1, ; |
| ethyl 2-(N-phenylamino)thiazole-4-carboxylate |
| 4-Thiazolecarboxylic acid, 2-(phenylamino)-, ethyl ester |
| ethyl 2-(phenylamino)-1,3-thiazole-4-carboxylate |
| Ethyl 2-(phenylamino)-4-thiazolecarboxylate |
| Ethyl 2-anilino-1,3-thiazole-4-carboxylate |
| ethyl 2-anilinothiazole-4-carboxylate |
| 4-Thiazolecarboxylicacid,2-(phenylamino)-,ethyl ester |