MRE-269-d7 structure
|
Common Name | MRE-269-d7 | ||
|---|---|---|---|---|
| CAS Number | 1265295-20-2 | Molecular Weight | 426.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22D7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MRE-269-d7MRE-269-d7 is deuterium labeled MRE-269 (HY-79593). MRE-269 is an active metabolite of selexipag, and acts as a selective IP receptor agonist[1][2]. |
| Name | MRE-269-d7 |
|---|
| Description | MRE-269-d7 is deuterium labeled MRE-269 (HY-79593). MRE-269 is an active metabolite of selexipag, and acts as a selective IP receptor agonist[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C25H22D7N3O3 |
|---|---|
| Molecular Weight | 426.56 |
| InChIKey | OJQMKCBWYCWFPU-HXAWLNHQSA-N |
| SMILES | CC(C)N(CCCCOCC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |