5-Amino-3-tert-butyl-1-phenylpyrazole structure
|
Common Name | 5-Amino-3-tert-butyl-1-phenylpyrazole | ||
|---|---|---|---|---|
| CAS Number | 126208-61-5 | Molecular Weight | 215.294 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 356.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H17N3 | Melting Point | 59-61ºC | |
| MSDS | USA | Flash Point | 169.3±24.6 °C | |
| Name | 5-tert-butyl-2-phenylpyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.3±30.0 °C at 760 mmHg |
| Melting Point | 59-61ºC |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.294 |
| Flash Point | 169.3±24.6 °C |
| Exact Mass | 215.142242 |
| PSA | 43.84000 |
| LogP | 3.19 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | GFWSTBBSSBVVQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(N)n(-c2ccccc2)n1 |
|
~69%
5-Amino-3-tert-... CAS#:126208-61-5 |
| Literature: US2006/35922 A1, ; Page/Page column 30 ; US 20060035922 A1 |
|
~94%
5-Amino-3-tert-... CAS#:126208-61-5 |
| Literature: Organic and Biomolecular Chemistry, , vol. 4, # 22 p. 4158 - 4164 |
|
~79%
5-Amino-3-tert-... CAS#:126208-61-5 |
| Literature: Tetrahedron Letters, , vol. 43, # 12 p. 2171 - 2173 |
|
~%
5-Amino-3-tert-... CAS#:126208-61-5 |
| Literature: Tetrahedron Letters, , vol. 43, # 12 p. 2171 - 2173 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazol-5-amine, 3-(1,1-dimethylethyl)-1-phenyl- |
| 5-Amino-3-tert-butyl-1-phenylpyrazole |
| 3-amino-5-tert-butyl-2-phenyl-2H-pyrazole |
| 5-amino-1-phenyl-3-tert-butylpyrazole |
| 5-tert-Butyl-2-phenyl-2H-pyrazol-3-ylamine |
| 3-(2-Methyl-2-propanyl)-1-phenyl-1H-pyrazol-5-amine |
| 5-amino-3-t-butyl-1-phenylpyrazole |
| 5-amino-3-tert-butyl-1-phenyl-1H-pyrazole |
| MFCD02091535 |
| 3-(2-Methyl-2-propanyl)-1-phenyl-1H-pyrazol-5-amin |
| 3-tert-Butyl-1-phenyl-1H-pyrazol-5-amine |