Rafutrombopag diolamine structure
|
Common Name | Rafutrombopag diolamine | ||
|---|---|---|---|---|
| CAS Number | 1257792-42-9 | Molecular Weight | 580.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H36N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rafutrombopag diolamineRafutrombopag diolamine is the derivative of Rafutrombopag. Rafutrombopag is a thrombopoietin receptor agonist[1]. |
| Name | Rafutrombopag diolamine |
|---|
| Description | Rafutrombopag diolamine is the derivative of Rafutrombopag. Rafutrombopag is a thrombopoietin receptor agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H36N6O7 |
|---|---|
| Molecular Weight | 580.63 |
| InChIKey | RKEJRDZRWWDSRX-UHFFFAOYSA-N |
| SMILES | Cc1[nH]n(-c2ccc3c(c2)CCCC3)c(=O)c1N=Nc1cccc(-c2ccc(C(=O)O)o2)c1O.NCCO.NCCO |