S-Fcme structure
|
Common Name | S-Fcme | ||
|---|---|---|---|---|
| CAS Number | 125741-64-2 | Molecular Weight | 339.54 | |
| Density | 0.987g/cm3 | Boiling Point | 446.7ºC at 760mmHg | |
| Molecular Formula | C19H33NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.9ºC | |
Use of S-FcmeS-tram,tram-Farnesylated cysteine methyl ester is a multidrug resistance transporter activator. S-tram,tram-Farnesylated cysteine methyl ester acts by stimulating the multidrug resistance transporter ATPase activity and competing for drug binding[1]. |
| Name | S-[(2E,6E)-farnesyl]-L-cysteine methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | S-tram,tram-Farnesylated cysteine methyl ester is a multidrug resistance transporter activator. S-tram,tram-Farnesylated cysteine methyl ester acts by stimulating the multidrug resistance transporter ATPase activity and competing for drug binding[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.987g/cm3 |
|---|---|
| Boiling Point | 446.7ºC at 760mmHg |
| Molecular Formula | C19H33NO2S |
| Molecular Weight | 339.54 |
| Flash Point | 223.9ºC |
| Exact Mass | 339.22300 |
| PSA | 77.62000 |
| LogP | 5.33940 |
| Vapour Pressure | 3.58E-08mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | SIEHZFPZQUNSAS-GCVUPTOQSA-N |
| SMILES | COC(=O)C(N)CSCC=C(C)CCC=C(C)CCC=C(C)C |
| S-farnesyl-L-cysteine methyl ester |
| S-Fcme |
| S-FARNESYL-L-CYSTEINE ME |
| Farnesylcysteine methyl ester |
| BML2-C12 |
| Cys(Far)-OMe |
| methyl (2R)-2-amino-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoate |