Hexaethylene glycol phosphoramidite structure
|
Common Name | Hexaethylene glycol phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 125607-09-2 | Molecular Weight | 784.91500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H61N2O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hexaethylene glycol phosphoramiditeHexaethylene glycol phosphoramidite (Spacer Phosphoramidite 18) is an amidite reagent for oligonucleotide synthesis. Hexaethylene glycol phosphoramidite can be used as a linker in synthesis of nucleotide chain and qPCR probes[1][2]. |
| Name | 1-O-DMT-6-β-cyanoethyl-N,N-diisopropylphosphoramidite-hexaethylene glycol |
|---|
| Description | Hexaethylene glycol phosphoramidite (Spacer Phosphoramidite 18) is an amidite reagent for oligonucleotide synthesis. Hexaethylene glycol phosphoramidite can be used as a linker in synthesis of nucleotide chain and qPCR probes[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C42H61N2O10P |
|---|---|
| Molecular Weight | 784.91500 |
| Exact Mass | 784.40600 |
| PSA | 132.92000 |
| LogP | 7.38788 |
| InChIKey | ZTCKUVQHKIMCLI-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(OCCOCCOCCOCCOCCOCCOP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |