[Leu31,Pro34]-Neuropeptide Y (porcine)
Modify Date: 2025-08-22 13:05:33
![[Leu31,Pro34]-Neuropeptide Y (porcine) Structure](https://image.chemsrc.com/caspic/066/125580-28-1.png)
[Leu31,Pro34]-Neuropeptide Y (porcine) structure
|
Common Name | [Leu31,Pro34]-Neuropeptide Y (porcine) | ||
|---|---|---|---|---|
| CAS Number | 125580-28-1 | Molecular Weight | 4222.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C190H286N54O56 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of [Leu31,Pro34]-Neuropeptide Y (porcine)[Leu31,Pro34]- Neuropeptide Y (porcine), a Neuropeptide Y (NPY) analog, is a selective NPY Y1 receptor agonist. [Leu31,Pro34]- Neuropeptide Y (porcine) exhibits anxiolytic effects[1][2]. |
| Name | [Leu31, Pro34]-Neuropeptide Y porcine |
|---|
| Description | [Leu31,Pro34]- Neuropeptide Y (porcine), a Neuropeptide Y (NPY) analog, is a selective NPY Y1 receptor agonist. [Leu31,Pro34]- Neuropeptide Y (porcine) exhibits anxiolytic effects[1][2]. |
|---|---|
| Related Catalog | |
| Target |
NPY Y1 receptor |
| In Vivo | [Leu31,Pro34]-Neuropeptide Y (porcine) displaces radiolabeled NPY from cells that express Y1 receptors in a series of human neuroblastoma cell lines and on rat PC-12 cells[1]. |
| References |
| Molecular Formula | C190H286N54O56 |
|---|---|
| Molecular Weight | 4222.63 |
| InChIKey | ZNBZLZXDILRJJT-CCPZSHQESA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1c[nH]cn1)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCNC(=N)N)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(C)NC(=O)C1CCCN1C(=O)C(C)NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)CNC(=O)C1CCCN1C(=O)C(CC(N)=O)NC(=O)C(CC(=O)O)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(CO)NC(=O)C1CCCN1C(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(CCCNC(=N)N)C(=O)N1CCCC1C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1ccc(O)cc1)C(N)=O)C(C)O |
| Storage condition | −20°C |
| WGK Germany | 3 |
|---|