Phosphonium,[[4-(methoxycarbonyl)phenyl]methyl]triphenyl-, chloride (1:1)
Modify Date: 2025-08-26 20:30:22
![Phosphonium,[[4-(methoxycarbonyl)phenyl]methyl]triphenyl-, chloride (1:1) Structure](https://image.chemsrc.com/caspic/476/1253-47-0.png)
Phosphonium,[[4-(methoxycarbonyl)phenyl]methyl]triphenyl-, chloride (1:1) structure
|
Common Name | Phosphonium,[[4-(methoxycarbonyl)phenyl]methyl]triphenyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1253-47-0 | Molecular Weight | 446.90500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H24ClO2P | Melting Point | 258-260ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxycarbonylphenyl)methyl-triphenylphosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 258-260ºC |
|---|---|
| Molecular Formula | C27H24ClO2P |
| Molecular Weight | 446.90500 |
| Exact Mass | 446.12000 |
| PSA | 39.89000 |
| LogP | 1.97130 |
| InChIKey | NKKAHXNONUTMEY-UHFFFAOYSA-M |
| SMILES | COC(=O)c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Cl-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2931900090 |
|
~%
Phosphonium,[[4... CAS#:1253-47-0 |
| Literature: Campbell; McDonald Journal of Organic Chemistry, 1959 , vol. 24, p. 1246,1250 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-carbomethoxybenzyl triphenylphosphonium chloride |
| (4-Methoxycarbonyl-benzyl)-triphenyl-phosphonium,Chlorid |
| 4-Methoxycarbonyl-benzyltriphenylphosphoniumchloride |
| RW3697 |
| triphenyl (4-methoxycarbonylbenzyl)phosphonium chloride |
| methyl 4-[(triphenylphosphino)methyl]benzoate,chloride |
| MFCD02683069 |
| 4-methoxycarbonylbenzyltriphenylphosphonium chloride |