2-(4-BROMOBUTYL)-5-NITRO-1H-ISOINDOLE-1,3(2H)-DIONE structure
|
Common Name | 2-(4-BROMOBUTYL)-5-NITRO-1H-ISOINDOLE-1,3(2H)-DIONE | ||
|---|---|---|---|---|
| CAS Number | 125207-39-8 | Molecular Weight | 327.13100 | |
| Density | 1.65g/cm3 | Boiling Point | 459.4ºC at 760mmHg | |
| Molecular Formula | C12H11BrN2O4 | Melting Point | 102-104ºC | |
| MSDS | N/A | Flash Point | 231.6ºC | |
| Name | 2-(4-bromobutyl)-5-nitroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 459.4ºC at 760mmHg |
| Melting Point | 102-104ºC |
| Molecular Formula | C12H11BrN2O4 |
| Molecular Weight | 327.13100 |
| Flash Point | 231.6ºC |
| Exact Mass | 325.99000 |
| PSA | 83.20000 |
| LogP | 2.82700 |
| Vapour Pressure | 1.27E-08mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | MQBKILMXULFSRI-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCCCBr |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2925190090 |
|
~%
2-(4-BROMOBUTYL... CAS#:125207-39-8 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US5025033 A1, 1991 ; US 5025033 A |
|
~%
2-(4-BROMOBUTYL... CAS#:125207-39-8 |
| Literature: Bian, Xiaoli; Wang, Qian; Ke, Changhu; Zhao, Guilan; Li, Yiping Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 7 p. 2022 - 2026 |
|
~%
2-(4-BROMOBUTYL... CAS#:125207-39-8 |
| Literature: Bian, Xiaoli; Wang, Qian; Ke, Changhu; Zhao, Guilan; Li, Yiping Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 7 p. 2022 - 2026 |
|
~%
2-(4-BROMOBUTYL... CAS#:125207-39-8 |
| Literature: Ishihara; Kato; Goto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 12 p. 3225 - 3235 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H-Isoindole-1,3(2H)-dione,2-(4-bromobutyl)-5-nitro |
| N-(4-Bromobut-1-yl)-4-nitrophthalimide |
| 2-(4-Bromobutyl)-5-nitro-1H-isoindole-1,3(2H)-dione |