Bayer-18
Modify Date: 2025-09-17 18:27:14
Bayer-18 structure
|
Common Name | Bayer-18 | ||
|---|---|---|---|---|
| CAS Number | 1251752-12-1 | Molecular Weight | 390.455 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H27FN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bayer-18Bayer-18 is a selective TYK2 inhibitor, with an IC50 of 18.7nM on TYK2 as measured by TYK2 HTRF assays. |
| Name | 1-[3-({5-Fluoro-4-[(1-hydroxy-2-methyl-2-propanyl)amino]-2-pyrimidinyl}amino)phenyl]-3-(2-methyl-2-propanyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C19H27FN6O2 |
| Molecular Weight | 390.455 |
| Exact Mass | 390.217957 |
| LogP | 1.85 |
| Index of Refraction | 1.632 |
| InChIKey | DYNMZYFOSRSMAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)Nc1cccc(Nc2ncc(F)c(NC(C)(C)CO)n2)c1 |
| Urea, N-(1,1-dimethylethyl)-N'-[3-[[5-fluoro-4-[(2-hydroxy-1,1-dimethylethyl)amino]-2-pyrimidinyl]amino]phenyl]- |
| 1-[3-({5-Fluoro-4-[(1-hydroxy-2-methyl-2-propanyl)amino]-2-pyrimidinyl}amino)phenyl]-3-(2-methyl-2-propanyl)urea |