3-(Boc-aminomethyl)-3-hydroxypyrrolidine structure
|
Common Name | 3-(Boc-aminomethyl)-3-hydroxypyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 125033-59-2 | Molecular Weight | 216.277 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.8±17.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2±20.9 °C | |
| Name | tert-butyl N-[(3-hydroxypyrrolidin-3-yl)methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.8±17.0 °C at 760 mmHg |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.277 |
| Flash Point | 170.2±20.9 °C |
| Exact Mass | 216.147400 |
| PSA | 74.08000 |
| LogP | 0.11 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | CDXOWYHAHPHSRG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(O)CCNC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid, N-[(3-hydroxy-3-pyrrolidinyl)methyl]-, 1,1-dimethylethyl ester |
| 3-tert.-butoxycarbonylaminomethyl-3-hydroxypyrrolidine |
| 2-Methyl-2-propanyl [(3-hydroxy-3-pyrrolidinyl)methyl]carbamate |